C32H30N4O6S — CID 71465298
[4-[[3-[(1-benzoylpiperidin-4-yl)methyl]-2,5-dioxoimidazolidin-4-yl]methyl]phenyl] isoquinoline-5-sulfonate (PubChem CID 71465298) has the molecular formula C32H30N4O6S and a molecular weight of 598.68 g/mol. Its IUPAC name is [4-[[3-[(1-benzoylpiperidin-4-yl)methyl]-2,5-dioxoimidazolidin-4-yl]methyl]phenyl] isoquinoline-5-sulfonate.
| Compound Name | [4-[[3-[(1-benzoylpiperidin-4-yl)methyl]-2,5-dioxoimidazolidin-4-yl]methyl]phenyl] isoquinoline-5-sulfonate |
|---|---|
| PubChem CID | 71465298 |
| Molecular Formula | C32H30N4O6S |
| Molecular Weight | 598.68 g/mol |
| Exact Mass | 598.19 |
| IUPAC Name | [4-[[3-[(1-benzoylpiperidin-4-yl)methyl]-2,5-dioxoimidazolidin-4-yl]methyl]phenyl] isoquinoline-5-sulfonate |
| SMILES | O=C1NC(=O)N(CC2CCN(C(=O)c3ccccc3)CC2)C1Cc1ccc(OS(=O)(=O)c2cccc3cnccc23)cc1 |
| InChI | InChI=1S/C32H30N4O6S/c37-30-28(36(32(39)34-30)21-23-14-17-35(18-15-23)31(38)24-5-2-1-3-6-24)19-22-9-11-26(12-10-22)42-43(40,41)29-8-4-7-25-20-33-16-13-27(25)29/h1-13,16,20,23,28H,14-15,17-19,21H2,(H,34,37,39) |
| InChIKey | PASRPGOEFLIQSJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 125.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.68 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|