About 2-cyclopentylethyl N-(2-amino-5-thiophen-2-ylphenyl)carbamate
2-cyclopentylethyl N-(2-amino-5-thiophen-2-ylphenyl)carbamate (PubChem CID 71465702) has the molecular formula C18H22N2O2S
and a molecular weight of 330.45 g/mol. Its IUPAC name is 2-cyclopentylethyl N-(2-amino-5-thiophen-2-ylphenyl)carbamate.
Molecular Properties
| Compound Name | 2-cyclopentylethyl N-(2-amino-5-thiophen-2-ylphenyl)carbamate |
| PubChem CID | 71465702 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 2-cyclopentylethyl N-(2-amino-5-thiophen-2-ylphenyl)carbamate |
| SMILES | Nc1ccc(-c2cccs2)cc1NC(=O)OCCC1CCCC1 |
| InChI | InChI=1S/C18H22N2O2S/c19-15-8-7-14(17-6-3-11-23-17)12-16(15)20-18(21)22-10-9-13-4-1-2-5-13/h3,6-8,11-13H,1-2,4-5,9-10,19H2,(H,20,21) |
| InChIKey | SQGDDCBQTZCWRH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopentylethyl N-(2-amino-5-thiophen-2-ylphenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentylethyl N-(2-amino-5-thiophen-2-ylphenyl)carbamate?
The IUPAC name of 2-cyclopentylethyl N-(2-amino-5-thiophen-2-ylphenyl)carbamate (CID 71465702) is 2-cyclopentylethyl N-(2-amino-5-thiophen-2-ylphenyl)carbamate.
What is the SMILES notation for 2-cyclopentylethyl N-(2-amino-5-thiophen-2-ylphenyl)carbamate?
The canonical SMILES for 2-cyclopentylethyl N-(2-amino-5-thiophen-2-ylphenyl)carbamate is Nc1ccc(-c2cccs2)cc1NC(=O)OCCC1CCCC1.
What is the InChIKey of 2-cyclopentylethyl N-(2-amino-5-thiophen-2-ylphenyl)carbamate?
The InChIKey is SQGDDCBQTZCWRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O2S/c19-15-8-7-14(17-6-3-11-23-17)12-16(15)20-18(21)22-10-9-13-4-1-2-5-13/h3,6-8,11-13H,1-2,4-5,9-10,19H2,(H,20,21).
What are the key properties of 2-cyclopentylethyl N-(2-amino-5-thiophen-2-ylphenyl)carbamate?
2-cyclopentylethyl N-(2-amino-5-thiophen-2-ylphenyl)carbamate has a molecular weight of 330.45 g/mol, XLogP of 5.13, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentylethyl N-(2-amino-5-thiophen-2-ylphenyl)carbamate is sourced from PubChem (CID 71465702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).