C15H16ClN3OS — CID 71465773
N-[2-amino-5-(5-chlorothiophen-2-yl)phenyl]pyrrolidine-1-carboxamide (PubChem CID 71465773) has the molecular formula C15H16ClN3OS and a molecular weight of 321.83 g/mol. Its IUPAC name is N-[2-amino-5-(5-chlorothiophen-2-yl)phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[2-amino-5-(5-chlorothiophen-2-yl)phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 71465773 |
| Molecular Formula | C15H16ClN3OS |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | N-[2-amino-5-(5-chlorothiophen-2-yl)phenyl]pyrrolidine-1-carboxamide |
| SMILES | Nc1ccc(-c2ccc(Cl)s2)cc1NC(=O)N1CCCC1 |
| InChI | InChI=1S/C15H16ClN3OS/c16-14-6-5-13(21-14)10-3-4-11(17)12(9-10)18-15(20)19-7-1-2-8-19/h3-6,9H,1-2,7-8,17H2,(H,18,20) |
| InChIKey | SBEQYIIXOJFYBD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|