C24H22ClN5 — CID 71466420
(4R)-6-(4-chlorophenyl)-1,4-dimethyl-8-(6-methyl-3-pyridinyl)-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepine (PubChem CID 71466420) has the molecular formula C24H22ClN5 and a molecular weight of 415.93 g/mol. Its IUPAC name is (4R)-6-(4-chlorophenyl)-1,4-dimethyl-8-(6-methyl-3-pyridinyl)-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepine.
| Compound Name | (4R)-6-(4-chlorophenyl)-1,4-dimethyl-8-(6-methyl-3-pyridinyl)-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepine |
|---|---|
| PubChem CID | 71466420 |
| Molecular Formula | C24H22ClN5 |
| Molecular Weight | 415.93 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | (4R)-6-(4-chlorophenyl)-1,4-dimethyl-8-(6-methyl-3-pyridinyl)-4,5-dihydro-[1,2,4]triazolo[3,4-d][1,5]benzodiazepine |
| SMILES | Cc1ccc(-c2ccc3c(c2)N(c2ccc(Cl)cc2)C[C@@H](C)c2nnc(C)n2-3)cn1 |
| InChI | InChI=1S/C24H22ClN5/c1-15-14-29(21-9-7-20(25)8-10-21)23-12-18(19-5-4-16(2)26-13-19)6-11-22(23)30-17(3)27-28-24(15)30/h4-13,15H,14H2,1-3H3/t15-/m1/s1 |
| InChIKey | APBJGATVIQPHOY-OAHLLOKOSA-N |
| XLogP | 5.85 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.93 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|