C11H15ClO4 — CID 71466781
(3S,4aS,8aR)-3-(3-chloropropyl)-8a-methyl-4a,5-dihydro-1,2,4-benzotrioxin-6-one (PubChem CID 71466781) has the molecular formula C11H15ClO4 and a molecular weight of 246.69 g/mol. Its IUPAC name is (3S,4aS,8aR)-3-(3-chloropropyl)-8a-methyl-4a,5-dihydro-1,2,4-benzotrioxin-6-one.
| Compound Name | (3S,4aS,8aR)-3-(3-chloropropyl)-8a-methyl-4a,5-dihydro-1,2,4-benzotrioxin-6-one |
|---|---|
| PubChem CID | 71466781 |
| Molecular Formula | C11H15ClO4 |
| Molecular Weight | 246.69 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | (3S,4aS,8aR)-3-(3-chloropropyl)-8a-methyl-4a,5-dihydro-1,2,4-benzotrioxin-6-one |
| SMILES | C[C@@]12C=CC(=O)C[C@@H]1O[C@H](CCCCl)OO2 |
| InChI | InChI=1S/C11H15ClO4/c1-11-5-4-8(13)7-9(11)14-10(15-16-11)3-2-6-12/h4-5,9-10H,2-3,6-7H2,1H3/t9-,10-,11+/m0/s1 |
| InChIKey | UCEAUBZKIVCNTG-GARJFASQSA-N |
| XLogP | 1.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.69 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|