About tert-butyl 4-acetyl-3-nitrobenzoate
tert-butyl 4-acetyl-3-nitrobenzoate (PubChem CID 71466813) has the molecular formula C13H15NO5
and a molecular weight of 265.26 g/mol. Its IUPAC name is tert-butyl 4-acetyl-3-nitrobenzoate.
Molecular Properties
| Compound Name | tert-butyl 4-acetyl-3-nitrobenzoate |
| PubChem CID | 71466813 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | tert-butyl 4-acetyl-3-nitrobenzoate |
| SMILES | CC(=O)c1ccc(C(=O)OC(C)(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15NO5/c1-8(15)10-6-5-9(7-11(10)14(17)18)12(16)19-13(2,3)4/h5-7H,1-4H3 |
| InChIKey | DYAUKUYJOIKVJV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-acetyl-3-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-acetyl-3-nitrobenzoate?
The IUPAC name of tert-butyl 4-acetyl-3-nitrobenzoate (CID 71466813) is tert-butyl 4-acetyl-3-nitrobenzoate.
What is the SMILES notation for tert-butyl 4-acetyl-3-nitrobenzoate?
The canonical SMILES for tert-butyl 4-acetyl-3-nitrobenzoate is CC(=O)c1ccc(C(=O)OC(C)(C)C)cc1[N+](=O)[O-].
What is the InChIKey of tert-butyl 4-acetyl-3-nitrobenzoate?
The InChIKey is DYAUKUYJOIKVJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO5/c1-8(15)10-6-5-9(7-11(10)14(17)18)12(16)19-13(2,3)4/h5-7H,1-4H3.
What are the key properties of tert-butyl 4-acetyl-3-nitrobenzoate?
tert-butyl 4-acetyl-3-nitrobenzoate has a molecular weight of 265.26 g/mol, XLogP of 2.75, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-acetyl-3-nitrobenzoate is sourced from PubChem (CID 71466813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).