C37H38N2O2P2 — CID 71466942
N-diphenylphosphoryl-N-[[(2S)-1-diphenylphosphorylpyrrolidin-2-yl]methyl]-2-phenylethanamine (PubChem CID 71466942) has the molecular formula C37H38N2O2P2 and a molecular weight of 604.67 g/mol. Its IUPAC name is N-diphenylphosphoryl-N-[[(2S)-1-diphenylphosphorylpyrrolidin-2-yl]methyl]-2-phenylethanamine.
| Compound Name | N-diphenylphosphoryl-N-[[(2S)-1-diphenylphosphorylpyrrolidin-2-yl]methyl]-2-phenylethanamine |
|---|---|
| PubChem CID | 71466942 |
| Molecular Formula | C37H38N2O2P2 |
| Molecular Weight | 604.67 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | N-diphenylphosphoryl-N-[[(2S)-1-diphenylphosphorylpyrrolidin-2-yl]methyl]-2-phenylethanamine |
| SMILES | O=P(c1ccccc1)(c1ccccc1)N(CCc1ccccc1)C[C@@H]1CCCN1P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H38N2O2P2/c40-42(34-20-8-2-9-21-34,35-22-10-3-11-23-35)38(30-28-32-17-6-1-7-18-32)31-33-19-16-29-39(33)43(41,36-24-12-4-13-25-36)37-26-14-5-15-27-37/h1-15,17-18,20-27,33H,16,19,28-31H2/t33-/m0/s1 |
| InChIKey | APRPMGSPBXPYIS-XIFFEERXSA-N |
| XLogP | 6.85 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.67 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|