About (3,5,6-trimethylpyrazin-2-yl)methyl (2S)-2-methylbutanoate
(3,5,6-trimethylpyrazin-2-yl)methyl (2S)-2-methylbutanoate (PubChem CID 71467095) has the molecular formula C13H20N2O2
and a molecular weight of 236.31 g/mol. Its IUPAC name is (3,5,6-trimethylpyrazin-2-yl)methyl (2S)-2-methylbutanoate.
Molecular Properties
| Compound Name | (3,5,6-trimethylpyrazin-2-yl)methyl (2S)-2-methylbutanoate |
| PubChem CID | 71467095 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | (3,5,6-trimethylpyrazin-2-yl)methyl (2S)-2-methylbutanoate |
| SMILES | CC[C@H](C)C(=O)OCc1nc(C)c(C)nc1C |
| InChI | InChI=1S/C13H20N2O2/c1-6-8(2)13(16)17-7-12-11(5)14-9(3)10(4)15-12/h8H,6-7H2,1-5H3/t8-/m0/s1 |
| InChIKey | LDMNOWUFVWOZDR-QMMMGPOBSA-N |
| XLogP | 2.49 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3,5,6-trimethylpyrazin-2-yl)methyl (2S)-2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5,6-trimethylpyrazin-2-yl)methyl (2S)-2-methylbutanoate?
The IUPAC name of (3,5,6-trimethylpyrazin-2-yl)methyl (2S)-2-methylbutanoate (CID 71467095) is (3,5,6-trimethylpyrazin-2-yl)methyl (2S)-2-methylbutanoate.
What is the SMILES notation for (3,5,6-trimethylpyrazin-2-yl)methyl (2S)-2-methylbutanoate?
The canonical SMILES for (3,5,6-trimethylpyrazin-2-yl)methyl (2S)-2-methylbutanoate is CC[C@H](C)C(=O)OCc1nc(C)c(C)nc1C.
What is the InChIKey of (3,5,6-trimethylpyrazin-2-yl)methyl (2S)-2-methylbutanoate?
The InChIKey is LDMNOWUFVWOZDR-QMMMGPOBSA-N. The full InChI is InChI=1S/C13H20N2O2/c1-6-8(2)13(16)17-7-12-11(5)14-9(3)10(4)15-12/h8H,6-7H2,1-5H3/t8-/m0/s1.
What are the key properties of (3,5,6-trimethylpyrazin-2-yl)methyl (2S)-2-methylbutanoate?
(3,5,6-trimethylpyrazin-2-yl)methyl (2S)-2-methylbutanoate has a molecular weight of 236.31 g/mol, XLogP of 2.49, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5,6-trimethylpyrazin-2-yl)methyl (2S)-2-methylbutanoate is sourced from PubChem (CID 71467095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).