About 4-hexoxy-2-methyloxolane-2,3,3-triol
4-hexoxy-2-methyloxolane-2,3,3-triol (PubChem CID 71467257) has the molecular formula C11H22O5
and a molecular weight of 234.29 g/mol. Its IUPAC name is 4-hexoxy-2-methyloxolane-2,3,3-triol.
Molecular Properties
| Compound Name | 4-hexoxy-2-methyloxolane-2,3,3-triol |
| PubChem CID | 71467257 |
| Molecular Formula | C11H22O5 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 4-hexoxy-2-methyloxolane-2,3,3-triol |
| SMILES | CCCCCCOC1COC(C)(O)C1(O)O |
| InChI | InChI=1S/C11H22O5/c1-3-4-5-6-7-15-9-8-16-10(2,12)11(9,13)14/h9,12-14H,3-8H2,1-2H3 |
| InChIKey | HOCFPBWNVXGTFJ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-hexoxy-2-methyloxolane-2,3,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hexoxy-2-methyloxolane-2,3,3-triol?
The IUPAC name of 4-hexoxy-2-methyloxolane-2,3,3-triol (CID 71467257) is 4-hexoxy-2-methyloxolane-2,3,3-triol.
What is the SMILES notation for 4-hexoxy-2-methyloxolane-2,3,3-triol?
The canonical SMILES for 4-hexoxy-2-methyloxolane-2,3,3-triol is CCCCCCOC1COC(C)(O)C1(O)O.
What is the InChIKey of 4-hexoxy-2-methyloxolane-2,3,3-triol?
The InChIKey is HOCFPBWNVXGTFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O5/c1-3-4-5-6-7-15-9-8-16-10(2,12)11(9,13)14/h9,12-14H,3-8H2,1-2H3.
What are the key properties of 4-hexoxy-2-methyloxolane-2,3,3-triol?
4-hexoxy-2-methyloxolane-2,3,3-triol has a molecular weight of 234.29 g/mol, XLogP of 0.37, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hexoxy-2-methyloxolane-2,3,3-triol is sourced from PubChem (CID 71467257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).