About tert-butyl-dimethyl-[(7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indol-8-yl)oxy]silane
tert-butyl-dimethyl-[(7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indol-8-yl)oxy]silane (PubChem CID 71467272) has the molecular formula C18H27NOSi
and a molecular weight of 301.51 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indol-8-yl)oxy]silane.
Molecular Properties
| Compound Name | tert-butyl-dimethyl-[(7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indol-8-yl)oxy]silane |
| PubChem CID | 71467272 |
| Molecular Formula | C18H27NOSi |
| Molecular Weight | 301.51 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | tert-butyl-dimethyl-[(7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indol-8-yl)oxy]silane |
| SMILES | Cc1ccc2cc3n(c2c1O[Si](C)(C)C(C)(C)C)CCC3 |
| InChI | InChI=1S/C18H27NOSi/c1-13-9-10-14-12-15-8-7-11-19(15)16(14)17(13)20-21(5,6)18(2,3)4/h9-10,12H,7-8,11H2,1-6H3 |
| InChIKey | CDNZXRZPTAMDDL-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 301.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-dimethyl-[(7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indol-8-yl)oxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-dimethyl-[(7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indol-8-yl)oxy]silane?
The IUPAC name of tert-butyl-dimethyl-[(7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indol-8-yl)oxy]silane (CID 71467272) is tert-butyl-dimethyl-[(7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indol-8-yl)oxy]silane.
What is the SMILES notation for tert-butyl-dimethyl-[(7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indol-8-yl)oxy]silane?
The canonical SMILES for tert-butyl-dimethyl-[(7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indol-8-yl)oxy]silane is Cc1ccc2cc3n(c2c1O[Si](C)(C)C(C)(C)C)CCC3.
What is the InChIKey of tert-butyl-dimethyl-[(7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indol-8-yl)oxy]silane?
The InChIKey is CDNZXRZPTAMDDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27NOSi/c1-13-9-10-14-12-15-8-7-11-19(15)16(14)17(13)20-21(5,6)18(2,3)4/h9-10,12H,7-8,11H2,1-6H3.
What are the key properties of tert-butyl-dimethyl-[(7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indol-8-yl)oxy]silane?
tert-butyl-dimethyl-[(7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indol-8-yl)oxy]silane has a molecular weight of 301.51 g/mol, XLogP of 5.28, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-dimethyl-[(7-methyl-2,3-dihydro-1H-pyrrolo[1,2-a]indol-8-yl)oxy]silane is sourced from PubChem (CID 71467272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).