C22H19Cl2F3N2O4S — CID 71467510
methyl 2-[[3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophene-1-carbonyl]amino]acetate (PubChem CID 71467510) has the molecular formula C22H19Cl2F3N2O4S and a molecular weight of 535.37 g/mol. Its IUPAC name is methyl 2-[[3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophene-1-carbonyl]amino]acetate.
| Compound Name | methyl 2-[[3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophene-1-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 71467510 |
| Molecular Formula | C22H19Cl2F3N2O4S |
| Molecular Weight | 535.37 g/mol |
| Exact Mass | 534.04 |
| IUPAC Name | methyl 2-[[3-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophene-1-carbonyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1sc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)c2c1CCCC2 |
| InChI | InChI=1S/C22H19Cl2F3N2O4S/c1-32-17(30)10-28-20(31)19-15-5-3-2-4-14(15)18(34-19)16-9-21(33-29-16,22(25,26)27)11-6-12(23)8-13(24)7-11/h6-8H,2-5,9-10H2,1H3,(H,28,31) |
| InChIKey | XADBTRUUOLHATC-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.37 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |