C17H17ClFN5O4S2 — CID 71467722
5-[(4aS)-3-amino-2-methyl-1,1-dioxo-5,7,8,8a-tetrahydropyrano[3,4-e][1,2,4]thiadiazin-4a-yl]-4-chloro-N-(6-fluoro-2-pyridinyl)thiophene-2-carboxamide (PubChem CID 71467722) has the molecular formula C17H17ClFN5O4S2 and a molecular weight of 473.94 g/mol. Its IUPAC name is 5-[(4aS)-3-amino-2-methyl-1,1-dioxo-5,7,8,8a-tetrahydropyrano[3,4-e][1,2,4]thiadiazin-4a-yl]-4-chloro-N-(6-fluoro-2-pyridinyl)thiophene-2-carboxamide.
| Compound Name | 5-[(4aS)-3-amino-2-methyl-1,1-dioxo-5,7,8,8a-tetrahydropyrano[3,4-e][1,2,4]thiadiazin-4a-yl]-4-chloro-N-(6-fluoro-2-pyridinyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 71467722 |
| Molecular Formula | C17H17ClFN5O4S2 |
| Molecular Weight | 473.94 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | 5-[(4aS)-3-amino-2-methyl-1,1-dioxo-5,7,8,8a-tetrahydropyrano[3,4-e][1,2,4]thiadiazin-4a-yl]-4-chloro-N-(6-fluoro-2-pyridinyl)thiophene-2-carboxamide |
| SMILES | CN1C(N)=N[C@@]2(c3sc(C(=O)Nc4cccc(F)n4)cc3Cl)COCCC2S1(=O)=O |
| InChI | InChI=1S/C17H17ClFN5O4S2/c1-24-16(20)23-17(8-28-6-5-11(17)30(24,26)27)14-9(18)7-10(29-14)15(25)22-13-4-2-3-12(19)21-13/h2-4,7,11H,5-6,8H2,1H3,(H2,20,23)(H,21,22,25)/t11?,17-/m0/s1 |
| InChIKey | JVEVLIZLMMJITO-KLLZUTDZSA-N |
| XLogP | 1.76 |
| TPSA | 126.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.94 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|