C23H19Cl3F3N3O3S — CID 71467766
N-[(3R)-2-oxopyrrolidin-3-yl]-3-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxamide (PubChem CID 71467766) has the molecular formula C23H19Cl3F3N3O3S and a molecular weight of 580.84 g/mol. Its IUPAC name is N-[(3R)-2-oxopyrrolidin-3-yl]-3-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxamide.
| Compound Name | N-[(3R)-2-oxopyrrolidin-3-yl]-3-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxamide |
|---|---|
| PubChem CID | 71467766 |
| Molecular Formula | C23H19Cl3F3N3O3S |
| Molecular Weight | 580.84 g/mol |
| Exact Mass | 579.02 |
| IUPAC Name | N-[(3R)-2-oxopyrrolidin-3-yl]-3-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxamide |
| SMILES | O=C(N[C@@H]1CCNC1=O)c1sc(C2=NOC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)c2c1CCCC2 |
| InChI | InChI=1S/C23H19Cl3F3N3O3S/c24-13-7-10(8-14(25)17(13)26)22(23(27,28)29)9-16(32-35-22)18-11-3-1-2-4-12(11)19(36-18)21(34)31-15-5-6-30-20(15)33/h7-8,15H,1-6,9H2,(H,30,33)(H,31,34)/t15-,22?/m1/s1 |
| InChIKey | LJDOEOMGYYTKNO-JGHKVMFLSA-N |
| XLogP | 5.79 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.84 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|