C23H18Cl2F4N4O3S — CID 71467871
N-[2-(cyanomethylamino)-2-oxoethyl]-3-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxamide (PubChem CID 71467871) has the molecular formula C23H18Cl2F4N4O3S and a molecular weight of 577.39 g/mol. Its IUPAC name is N-[2-(cyanomethylamino)-2-oxoethyl]-3-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxamide.
| Compound Name | N-[2-(cyanomethylamino)-2-oxoethyl]-3-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxamide |
|---|---|
| PubChem CID | 71467871 |
| Molecular Formula | C23H18Cl2F4N4O3S |
| Molecular Weight | 577.39 g/mol |
| Exact Mass | 576.04 |
| IUPAC Name | N-[2-(cyanomethylamino)-2-oxoethyl]-3-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxamide |
| SMILES | N#CCNC(=O)CNC(=O)c1sc(C2=NOC(c3cc(Cl)c(F)c(Cl)c3)(C(F)(F)F)C2)c2c1CCCC2 |
| InChI | InChI=1S/C23H18Cl2F4N4O3S/c24-14-7-11(8-15(25)18(14)26)22(23(27,28)29)9-16(33-36-22)19-12-3-1-2-4-13(12)20(37-19)21(35)32-10-17(34)31-6-5-30/h7-8H,1-4,6,9-10H2,(H,31,34)(H,32,35) |
| InChIKey | BUSDAXXFLOZSSM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 103.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.39 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|