C24H24F4N6O — CID 71467969
[(3S)-1-[(1R)-1-[3-(7-ethoxy-6-fluoroquinolin-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-2,2,2-trifluoroethyl]pyrrolidin-3-yl]methanamine (PubChem CID 71467969) has the molecular formula C24H24F4N6O and a molecular weight of 488.49 g/mol. Its IUPAC name is [(3S)-1-[(1R)-1-[3-(7-ethoxy-6-fluoroquinolin-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-2,2,2-trifluoroethyl]pyrrolidin-3-yl]methanamine.
| Compound Name | [(3S)-1-[(1R)-1-[3-(7-ethoxy-6-fluoroquinolin-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-2,2,2-trifluoroethyl]pyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 71467969 |
| Molecular Formula | C24H24F4N6O |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | [(3S)-1-[(1R)-1-[3-(7-ethoxy-6-fluoroquinolin-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-2,2,2-trifluoroethyl]pyrrolidin-3-yl]methanamine |
| SMILES | CCOc1cc2nc(-c3nnc4ccc([C@@H](N5CC[C@@H](CN)C5)C(F)(F)F)cn34)ccc2cc1F |
| InChI | InChI=1S/C24H24F4N6O/c1-2-35-20-10-19-15(9-17(20)25)3-5-18(30-19)23-32-31-21-6-4-16(13-34(21)23)22(24(26,27)28)33-8-7-14(11-29)12-33/h3-6,9-10,13-14,22H,2,7-8,11-12,29H2,1H3/t14-,22+/m0/s1 |
| InChIKey | JZCGRDSFULISBM-RCDICMHDSA-N |
| XLogP | 4.37 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |