C26H31ClF3NaO10 — CID 71467990
sodium (2S,3S,4S,5R,6S)-6-[3-[7-chloro-3-ethyl-3'-(2,2,2-trifluoroethoxy)spiro[bicyclo[3.3.1]nonane-2,4'-dioxetane]-3'-yl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylate (PubChem CID 71467990) has the molecular formula C26H31ClF3NaO10 and a molecular weight of 618.96 g/mol. Its IUPAC name is sodium (2S,3S,4S,5R,6S)-6-[3-[7-chloro-3-ethyl-3'-(2,2,2-trifluoroethoxy)spiro[bicyclo[3.3.1]nonane-2,4'-dioxetane]-3'-yl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylate.
| Compound Name | sodium (2S,3S,4S,5R,6S)-6-[3-[7-chloro-3-ethyl-3'-(2,2,2-trifluoroethoxy)spiro[bicyclo[3.3.1]nonane-2,4'-dioxetane]-3'-yl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 71467990 |
| Molecular Formula | C26H31ClF3NaO10 |
| Molecular Weight | 618.96 g/mol |
| Exact Mass | 618.15 |
| IUPAC Name | sodium (2S,3S,4S,5R,6S)-6-[3-[7-chloro-3-ethyl-3'-(2,2,2-trifluoroethoxy)spiro[bicyclo[3.3.1]nonane-2,4'-dioxetane]-3'-yl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylate |
| SMILES | CCC1CC2CC(Cl)CC(C2)C12OOC2(OCC(F)(F)F)c1cccc(O[C@@H]2O[C@H](C(=O)[O-])[C@@H](O)[C@H](O)[C@H]2O)c1.[Na+] |
| InChI | InChI=1S/C26H32ClF3O10.Na/c1-2-13-6-12-7-15(9-16(27)8-12)25(13)26(40-39-25,36-11-24(28,29)30)14-4-3-5-17(10-14)37-23-20(33)18(31)19(32)21(38-23)22(34)35;/h3-5,10,12-13,15-16,18-21,23,31-33H,2,6-9,11H2,1H3,(H,34,35);/q;+1/p-1/t12?,13?,15?,16?,18-,19-,20+,21-,23+,25?,26?;/m0./s1 |
| InChIKey | BJNBYYNAZZYFLJ-NCZMRSOWSA-M |
| XLogP | -1.49 |
| TPSA | 146.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.96 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|