About CID 71468260
CID 71468260 (PubChem CID 71468260) has the molecular formula C24H39NO5S
and a molecular weight of 453.65 g/mol.
Molecular Properties
| Compound Name | CID 71468260 |
| PubChem CID | 71468260 |
| Molecular Formula | C24H39NO5S |
| Molecular Weight | 453.65 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | — |
| SMILES | CC1CCN(C[C@@H]2C(=O)O[C@H]3[C@H]2CCC2(CC2)[C@@H]2CCC4(CC4)[C@H]32)CC1.CS(=O)(=O)O |
| InChI | InChI=1S/C23H35NO2.CH4O3S/c1-15-4-12-24(13-5-15)14-17-16-2-6-22(8-9-22)18-3-7-23(10-11-23)19(18)20(16)26-21(17)25;1-5(2,3)4/h15-20H,2-14H2,1H3;1H3,(H,2,3,4)/t16-,17-,18+,19-,20-;/m0./s1 |
| InChIKey | MEPOSXVBUMJCAF-PUUHLBMISA-N |
| XLogP | 3.76 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.65 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 71468260 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71468260?
The IUPAC name of CID 71468260 (CID 71468260) is not available.
What is the SMILES notation for CID 71468260?
The canonical SMILES for CID 71468260 is CC1CCN(C[C@@H]2C(=O)O[C@H]3[C@H]2CCC2(CC2)[C@@H]2CCC4(CC4)[C@H]32)CC1.CS(=O)(=O)O.
What is the InChIKey of CID 71468260?
The InChIKey is MEPOSXVBUMJCAF-PUUHLBMISA-N. The full InChI is InChI=1S/C23H35NO2.CH4O3S/c1-15-4-12-24(13-5-15)14-17-16-2-6-22(8-9-22)18-3-7-23(10-11-23)19(18)20(16)26-21(17)25;1-5(2,3)4/h15-20H,2-14H2,1H3;1H3,(H,2,3,4)/t16-,17-,18+,19-,20-;/m0./s1.
What are the key properties of CID 71468260?
CID 71468260 has a molecular weight of 453.65 g/mol, XLogP of 3.76, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71468260 is sourced from PubChem (CID 71468260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).