C18H17N5O5S2 — CID 71468277
N-[5-(hydroxyamino)-5-oxopentyl]-5-(4-nitrophenyl)-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 71468277) has the molecular formula C18H17N5O5S2 and a molecular weight of 447.50 g/mol. Its IUPAC name is N-[5-(hydroxyamino)-5-oxopentyl]-5-(4-nitrophenyl)-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[5-(hydroxyamino)-5-oxopentyl]-5-(4-nitrophenyl)-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 71468277 |
| Molecular Formula | C18H17N5O5S2 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | N-[5-(hydroxyamino)-5-oxopentyl]-5-(4-nitrophenyl)-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(CCCCNC(=O)c1nc(-c2nccs2)sc1-c1ccc([N+](=O)[O-])cc1)NO |
| InChI | InChI=1S/C18H17N5O5S2/c24-13(22-26)3-1-2-8-19-16(25)14-15(11-4-6-12(7-5-11)23(27)28)30-18(21-14)17-20-9-10-29-17/h4-7,9-10,26H,1-3,8H2,(H,19,25)(H,22,24) |
| InChIKey | XJIIOWPKUDHNQA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 147.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|