C19H20N4O3S2 — CID 71468278
5-benzyl-N-[5-(hydroxyamino)-5-oxopentyl]-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 71468278) has the molecular formula C19H20N4O3S2 and a molecular weight of 416.53 g/mol. Its IUPAC name is 5-benzyl-N-[5-(hydroxyamino)-5-oxopentyl]-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 5-benzyl-N-[5-(hydroxyamino)-5-oxopentyl]-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 71468278 |
| Molecular Formula | C19H20N4O3S2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 5-benzyl-N-[5-(hydroxyamino)-5-oxopentyl]-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(CCCCNC(=O)c1nc(-c2nccs2)sc1Cc1ccccc1)NO |
| InChI | InChI=1S/C19H20N4O3S2/c24-15(23-26)8-4-5-9-20-17(25)16-14(12-13-6-2-1-3-7-13)28-19(22-16)18-21-10-11-27-18/h1-3,6-7,10-11,26H,4-5,8-9,12H2,(H,20,25)(H,23,24) |
| InChIKey | LDOPDZBQHBLKBC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|