C21H23N7O2 — CID 71468825
(6S)-8-(2,3-dimethyl-4-oxopyrido[1,2-a]pyrimidin-9-yl)-13-(methylamino)-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one (PubChem CID 71468825) has the molecular formula C21H23N7O2 and a molecular weight of 405.46 g/mol. Its IUPAC name is (6S)-8-(2,3-dimethyl-4-oxopyrido[1,2-a]pyrimidin-9-yl)-13-(methylamino)-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one.
| Compound Name | (6S)-8-(2,3-dimethyl-4-oxopyrido[1,2-a]pyrimidin-9-yl)-13-(methylamino)-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
|---|---|
| PubChem CID | 71468825 |
| Molecular Formula | C21H23N7O2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | (6S)-8-(2,3-dimethyl-4-oxopyrido[1,2-a]pyrimidin-9-yl)-13-(methylamino)-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
| SMILES | CNc1ncc2c(n1)N1CCC[C@H]1CN(c1cccn3c(=O)c(C)c(C)nc13)C2=O |
| InChI | InChI=1S/C21H23N7O2/c1-12-13(2)24-18-16(7-5-9-27(18)19(12)29)28-11-14-6-4-8-26(14)17-15(20(28)30)10-23-21(22-3)25-17/h5,7,9-10,14H,4,6,8,11H2,1-3H3,(H,22,23,25)/t14-/m0/s1 |
| InChIKey | DXNPMCAFAXVODX-AWEZNQCLSA-N |
| XLogP | 1.77 |
| TPSA | 95.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |