C20H21N7O2 — CID 71468826
(6S)-13-(methylamino)-8-(3-methyl-4-oxoquinazolin-8-yl)-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one (PubChem CID 71468826) has the molecular formula C20H21N7O2 and a molecular weight of 391.44 g/mol. Its IUPAC name is (6S)-13-(methylamino)-8-(3-methyl-4-oxoquinazolin-8-yl)-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one.
| Compound Name | (6S)-13-(methylamino)-8-(3-methyl-4-oxoquinazolin-8-yl)-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
|---|---|
| PubChem CID | 71468826 |
| Molecular Formula | C20H21N7O2 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | (6S)-13-(methylamino)-8-(3-methyl-4-oxoquinazolin-8-yl)-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
| SMILES | CNc1ncc2c(n1)N1CCC[C@H]1CN(c1cccc3c(=O)n(C)cnc13)C2=O |
| InChI | InChI=1S/C20H21N7O2/c1-21-20-22-9-14-17(24-20)26-8-4-5-12(26)10-27(19(14)29)15-7-3-6-13-16(15)23-11-25(2)18(13)28/h3,6-7,9,11-12H,4-5,8,10H2,1-2H3,(H,21,22,24)/t12-/m0/s1 |
| InChIKey | SAABWDLBBDBGBV-LBPRGKRZSA-N |
| XLogP | 1.39 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |