C13H16N4O3S2 — CID 71468928
N-[5-(hydroxyamino)-5-oxopentyl]-2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazole-4-carboxamide (PubChem CID 71468928) has the molecular formula C13H16N4O3S2 and a molecular weight of 340.43 g/mol. Its IUPAC name is N-[5-(hydroxyamino)-5-oxopentyl]-2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[5-(hydroxyamino)-5-oxopentyl]-2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 71468928 |
| Molecular Formula | C13H16N4O3S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | N-[5-(hydroxyamino)-5-oxopentyl]-2-(2-methyl-1,3-thiazol-4-yl)-1,3-thiazole-4-carboxamide |
| SMILES | Cc1nc(-c2nc(C(=O)NCCCCC(=O)NO)cs2)cs1 |
| InChI | InChI=1S/C13H16N4O3S2/c1-8-15-10(7-21-8)13-16-9(6-22-13)12(19)14-5-3-2-4-11(18)17-20/h6-7,20H,2-5H2,1H3,(H,14,19)(H,17,18) |
| InChIKey | YHULCWIEZUPPSB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|