C22H25N7O2 — CID 71468949
(6S)-8-(2,3-dimethyl-4-oxoquinazolin-8-yl)-13-(ethylamino)-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one (PubChem CID 71468949) has the molecular formula C22H25N7O2 and a molecular weight of 419.49 g/mol. Its IUPAC name is (6S)-8-(2,3-dimethyl-4-oxoquinazolin-8-yl)-13-(ethylamino)-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one.
| Compound Name | (6S)-8-(2,3-dimethyl-4-oxoquinazolin-8-yl)-13-(ethylamino)-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
|---|---|
| PubChem CID | 71468949 |
| Molecular Formula | C22H25N7O2 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | (6S)-8-(2,3-dimethyl-4-oxoquinazolin-8-yl)-13-(ethylamino)-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
| SMILES | CCNc1ncc2c(n1)N1CCC[C@H]1CN(c1cccc3c(=O)n(C)c(C)nc13)C2=O |
| InChI | InChI=1S/C22H25N7O2/c1-4-23-22-24-11-16-19(26-22)28-10-6-7-14(28)12-29(21(16)31)17-9-5-8-15-18(17)25-13(2)27(3)20(15)30/h5,8-9,11,14H,4,6-7,10,12H2,1-3H3,(H,23,24,26)/t14-/m0/s1 |
| InChIKey | YRCHSLILKMJEQM-AWEZNQCLSA-N |
| XLogP | 2.09 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |