C24H30N8O2 — CID 71468952
(6S)-8-[3-[3-(dimethylamino)propyl]-4-oxoquinazolin-8-yl]-13-(methylamino)-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one (PubChem CID 71468952) has the molecular formula C24H30N8O2 and a molecular weight of 462.56 g/mol. Its IUPAC name is (6S)-8-[3-[3-(dimethylamino)propyl]-4-oxoquinazolin-8-yl]-13-(methylamino)-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one.
| Compound Name | (6S)-8-[3-[3-(dimethylamino)propyl]-4-oxoquinazolin-8-yl]-13-(methylamino)-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
|---|---|
| PubChem CID | 71468952 |
| Molecular Formula | C24H30N8O2 |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | (6S)-8-[3-[3-(dimethylamino)propyl]-4-oxoquinazolin-8-yl]-13-(methylamino)-2,8,12,14-tetrazatricyclo[8.4.0.02,6]tetradeca-1(14),10,12-trien-9-one |
| SMILES | CNc1ncc2c(n1)N1CCC[C@H]1CN(c1cccc3c(=O)n(CCCN(C)C)cnc13)C2=O |
| InChI | InChI=1S/C24H30N8O2/c1-25-24-26-13-18-21(28-24)31-12-5-7-16(31)14-32(23(18)34)19-9-4-8-17-20(19)27-15-30(22(17)33)11-6-10-29(2)3/h4,8-9,13,15-16H,5-7,10-12,14H2,1-3H3,(H,25,26,28)/t16-/m0/s1 |
| InChIKey | BOGIJACPLKTSFO-INIZCTEOSA-N |
| XLogP | 1.81 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |