C20H29N5O5S2 — CID 71469043
tert-butyl N-[[4-[4-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]methyl]carbamate (PubChem CID 71469043) has the molecular formula C20H29N5O5S2 and a molecular weight of 483.62 g/mol. Its IUPAC name is tert-butyl N-[[4-[4-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[4-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 71469043 |
| Molecular Formula | C20H29N5O5S2 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | tert-butyl N-[[4-[4-[[7-(hydroxyamino)-7-oxoheptyl]carbamoyl]-1,3-thiazol-2-yl]-1,3-thiazol-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1nc(-c2nc(C(=O)NCCCCCCC(=O)NO)cs2)cs1 |
| InChI | InChI=1S/C20H29N5O5S2/c1-20(2,3)30-19(28)22-10-16-23-14(12-31-16)18-24-13(11-32-18)17(27)21-9-7-5-4-6-8-15(26)25-29/h11-12,29H,4-10H2,1-3H3,(H,21,27)(H,22,28)(H,25,26) |
| InChIKey | KIQYWHSUQPWDJR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 142.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|