C23H29N5O2S2 — CID 71469045
N-[6-(2-aminoanilino)-6-oxohexyl]-5-(2-methylpropyl)-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 71469045) has the molecular formula C23H29N5O2S2 and a molecular weight of 471.65 g/mol. Its IUPAC name is N-[6-(2-aminoanilino)-6-oxohexyl]-5-(2-methylpropyl)-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[6-(2-aminoanilino)-6-oxohexyl]-5-(2-methylpropyl)-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 71469045 |
| Molecular Formula | C23H29N5O2S2 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | N-[6-(2-aminoanilino)-6-oxohexyl]-5-(2-methylpropyl)-2-(1,3-thiazol-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | CC(C)Cc1sc(-c2nccs2)nc1C(=O)NCCCCCC(=O)Nc1ccccc1N |
| InChI | InChI=1S/C23H29N5O2S2/c1-15(2)14-18-20(28-23(32-18)22-26-12-13-31-22)21(30)25-11-7-3-4-10-19(29)27-17-9-6-5-8-16(17)24/h5-6,8-9,12-13,15H,3-4,7,10-11,14,24H2,1-2H3,(H,25,30)(H,27,29) |
| InChIKey | PJQXKFOXWRNODM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|