C27H28O3S — CID 71469217
(5R)-5-methyl-5-[(1E)-2-methylbuta-1,3-dienyl]-3-[5-(4-phenylphenyl)pentanoyl]thiolane-2,4-dione (PubChem CID 71469217) has the molecular formula C27H28O3S and a molecular weight of 432.59 g/mol. Its IUPAC name is (5R)-5-methyl-5-[(1E)-2-methylbuta-1,3-dienyl]-3-[5-(4-phenylphenyl)pentanoyl]thiolane-2,4-dione.
| Compound Name | (5R)-5-methyl-5-[(1E)-2-methylbuta-1,3-dienyl]-3-[5-(4-phenylphenyl)pentanoyl]thiolane-2,4-dione |
|---|---|
| PubChem CID | 71469217 |
| Molecular Formula | C27H28O3S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | (5R)-5-methyl-5-[(1E)-2-methylbuta-1,3-dienyl]-3-[5-(4-phenylphenyl)pentanoyl]thiolane-2,4-dione |
| SMILES | C=C/C(C)=C/[C@@]1(C)SC(=O)C(C(=O)CCCCc2ccc(-c3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C27H28O3S/c1-4-19(2)18-27(3)25(29)24(26(30)31-27)23(28)13-9-8-10-20-14-16-22(17-15-20)21-11-6-5-7-12-21/h4-7,11-12,14-18,24H,1,8-10,13H2,2-3H3/b19-18+/t24?,27-/m1/s1 |
| InChIKey | XJQYCNCLMDVHPJ-ALSKQQAQSA-N |
| XLogP | 5.99 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|