C13H16O4 — CID 71469478
(4R,5R,9R)-4-but-2-ynyl-9-ethenyl-9-methyl-1,3,7-trioxaspiro[4.4]nonan-6-one (PubChem CID 71469478) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is (4R,5R,9R)-4-but-2-ynyl-9-ethenyl-9-methyl-1,3,7-trioxaspiro[4.4]nonan-6-one.
| Compound Name | (4R,5R,9R)-4-but-2-ynyl-9-ethenyl-9-methyl-1,3,7-trioxaspiro[4.4]nonan-6-one |
|---|---|
| PubChem CID | 71469478 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (4R,5R,9R)-4-but-2-ynyl-9-ethenyl-9-methyl-1,3,7-trioxaspiro[4.4]nonan-6-one |
| SMILES | C=C[C@]1(C)COC(=O)[C@@]12OCO[C@@H]2CC#CC |
| InChI | InChI=1S/C13H16O4/c1-4-6-7-10-13(17-9-16-10)11(14)15-8-12(13,3)5-2/h5,10H,2,7-9H2,1,3H3/t10-,12-,13-/m1/s1 |
| InChIKey | CFMCVAGYFXBPGH-RAIGVLPGSA-N |
| XLogP | 1.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|