C25H42O7Si2 — CID 71469525
methyl 2-[(3aR,4R,5aR,6R,8bR)-4-[tert-butyl(dimethyl)silyl]oxy-6,8b-dimethyl-3,7-dioxo-3a-trimethylsilyloxy-1,4,5,6-tetrahydrocyclopenta[e][2]benzofuran-5a-yl]acetate (PubChem CID 71469525) has the molecular formula C25H42O7Si2 and a molecular weight of 510.78 g/mol. Its IUPAC name is methyl 2-[(3aR,4R,5aR,6R,8bR)-4-[tert-butyl(dimethyl)silyl]oxy-6,8b-dimethyl-3,7-dioxo-3a-trimethylsilyloxy-1,4,5,6-tetrahydrocyclopenta[e][2]benzofuran-5a-yl]acetate.
| Compound Name | methyl 2-[(3aR,4R,5aR,6R,8bR)-4-[tert-butyl(dimethyl)silyl]oxy-6,8b-dimethyl-3,7-dioxo-3a-trimethylsilyloxy-1,4,5,6-tetrahydrocyclopenta[e][2]benzofuran-5a-yl]acetate |
|---|---|
| PubChem CID | 71469525 |
| Molecular Formula | C25H42O7Si2 |
| Molecular Weight | 510.78 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | methyl 2-[(3aR,4R,5aR,6R,8bR)-4-[tert-butyl(dimethyl)silyl]oxy-6,8b-dimethyl-3,7-dioxo-3a-trimethylsilyloxy-1,4,5,6-tetrahydrocyclopenta[e][2]benzofuran-5a-yl]acetate |
| SMILES | COC(=O)C[C@@]12C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@]3(O[Si](C)(C)C)C(=O)OC[C@@]3(C)C1=CC(=O)[C@@H]2C |
| InChI | InChI=1S/C25H42O7Si2/c1-16-17(26)12-18-23(5)15-30-21(28)25(23,32-33(7,8)9)19(31-34(10,11)22(2,3)4)13-24(16,18)14-20(27)29-6/h12,16,19H,13-15H2,1-11H3/t16-,19+,23-,24+,25+/m0/s1 |
| InChIKey | BYMNZQUCPPREGK-WTKGBYKGSA-N |
| XLogP | 4.63 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.78 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|