C21H21NO4 — CID 71469541
3,4,5-trimethoxy-15-methyl-15-azatetracyclo[9.7.0.02,7.012,16]octadeca-1(11),2,4,6,12(16),13,17-heptaen-10-one (PubChem CID 71469541) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is 3,4,5-trimethoxy-15-methyl-15-azatetracyclo[9.7.0.02,7.012,16]octadeca-1(11),2,4,6,12(16),13,17-heptaen-10-one.
| Compound Name | 3,4,5-trimethoxy-15-methyl-15-azatetracyclo[9.7.0.02,7.012,16]octadeca-1(11),2,4,6,12(16),13,17-heptaen-10-one |
|---|---|
| PubChem CID | 71469541 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 3,4,5-trimethoxy-15-methyl-15-azatetracyclo[9.7.0.02,7.012,16]octadeca-1(11),2,4,6,12(16),13,17-heptaen-10-one |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc3c(ccn3C)c1C(=O)CC2 |
| InChI | InChI=1S/C21H21NO4/c1-22-10-9-13-15(22)7-6-14-18-12(5-8-16(23)19(13)14)11-17(24-2)20(25-3)21(18)26-4/h6-7,9-11H,5,8H2,1-4H3 |
| InChIKey | LQAPEKWDGYWSBZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |