About trans-2-O-benzyl 1-O-methyl (1S,2R)-1-fluorocyclopropane-1,2-dicarboxylate
trans-2-O-benzyl 1-O-methyl (1S,2R)-1-fluorocyclopropane-1,2-dicarboxylate (PubChem CID 71469720) has the molecular formula C13H13FO4
and a molecular weight of 252.24 g/mol. Its IUPAC name is trans-2-O-benzyl 1-O-methyl (1S,2R)-1-fluorocyclopropane-1,2-dicarboxylate.
Molecular Properties
| Compound Name | trans-2-O-benzyl 1-O-methyl (1S,2R)-1-fluorocyclopropane-1,2-dicarboxylate |
| PubChem CID | 71469720 |
| Molecular Formula | C13H13FO4 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | trans-2-O-benzyl 1-O-methyl (1S,2R)-1-fluorocyclopropane-1,2-dicarboxylate |
| SMILES | COC(=O)[C@]1(F)C[C@@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H13FO4/c1-17-12(16)13(14)7-10(13)11(15)18-8-9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3/t10-,13+/m1/s1 |
| InChIKey | SQHIRCKKVIZDKE-MFKMUULPSA-N |
| XLogP | 1.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze trans-2-O-benzyl 1-O-methyl (1S,2R)-1-fluorocyclopropane-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-2-O-benzyl 1-O-methyl (1S,2R)-1-fluorocyclopropane-1,2-dicarboxylate?
The IUPAC name of trans-2-O-benzyl 1-O-methyl (1S,2R)-1-fluorocyclopropane-1,2-dicarboxylate (CID 71469720) is trans-2-O-benzyl 1-O-methyl (1S,2R)-1-fluorocyclopropane-1,2-dicarboxylate.
What is the SMILES notation for trans-2-O-benzyl 1-O-methyl (1S,2R)-1-fluorocyclopropane-1,2-dicarboxylate?
The canonical SMILES for trans-2-O-benzyl 1-O-methyl (1S,2R)-1-fluorocyclopropane-1,2-dicarboxylate is COC(=O)[C@]1(F)C[C@@H]1C(=O)OCc1ccccc1.
What is the InChIKey of trans-2-O-benzyl 1-O-methyl (1S,2R)-1-fluorocyclopropane-1,2-dicarboxylate?
The InChIKey is SQHIRCKKVIZDKE-MFKMUULPSA-N. The full InChI is InChI=1S/C13H13FO4/c1-17-12(16)13(14)7-10(13)11(15)18-8-9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3/t10-,13+/m1/s1.
What are the key properties of trans-2-O-benzyl 1-O-methyl (1S,2R)-1-fluorocyclopropane-1,2-dicarboxylate?
trans-2-O-benzyl 1-O-methyl (1S,2R)-1-fluorocyclopropane-1,2-dicarboxylate has a molecular weight of 252.24 g/mol, XLogP of 1.63, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trans-2-O-benzyl 1-O-methyl (1S,2R)-1-fluorocyclopropane-1,2-dicarboxylate is sourced from PubChem (CID 71469720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).