C33H74O5Si4 — CID 71469753
(3R,4S,5R,7R)-3,4,7-tris[[tert-butyl(dimethyl)silyl]oxy]-5-methyl-8-triethylsilyloxyoctan-2-one (PubChem CID 71469753) has the molecular formula C33H74O5Si4 and a molecular weight of 663.29 g/mol. Its IUPAC name is (3R,4S,5R,7R)-3,4,7-tris[[tert-butyl(dimethyl)silyl]oxy]-5-methyl-8-triethylsilyloxyoctan-2-one.
| Compound Name | (3R,4S,5R,7R)-3,4,7-tris[[tert-butyl(dimethyl)silyl]oxy]-5-methyl-8-triethylsilyloxyoctan-2-one |
|---|---|
| PubChem CID | 71469753 |
| Molecular Formula | C33H74O5Si4 |
| Molecular Weight | 663.29 g/mol |
| Exact Mass | 662.46 |
| IUPAC Name | (3R,4S,5R,7R)-3,4,7-tris[[tert-butyl(dimethyl)silyl]oxy]-5-methyl-8-triethylsilyloxyoctan-2-one |
| SMILES | CC[Si](CC)(CC)OC[C@@H](C[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(C)=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H74O5Si4/c1-21-42(22-2,23-3)35-25-28(36-39(15,16)31(6,7)8)24-26(4)29(37-40(17,18)32(9,10)11)30(27(5)34)38-41(19,20)33(12,13)14/h26,28-30H,21-25H2,1-20H3/t26-,28-,29+,30+/m1/s1 |
| InChIKey | BRRJYIBSYLDURA-OKCNIUFZSA-N |
| XLogP | 10.79 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.29 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|