C27H27F6N3O2 — CID 71470634
1,1,1,3,3,3-hexafluoro-2-[4-[3-methoxy-4-[[4-(pyridin-4-ylmethyl)piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol (PubChem CID 71470634) has the molecular formula C27H27F6N3O2 and a molecular weight of 539.52 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-[3-methoxy-4-[[4-(pyridin-4-ylmethyl)piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-[3-methoxy-4-[[4-(pyridin-4-ylmethyl)piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 71470634 |
| Molecular Formula | C27H27F6N3O2 |
| Molecular Weight | 539.52 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-[3-methoxy-4-[[4-(pyridin-4-ylmethyl)piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol |
| SMILES | COc1cc(-c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)ccc1CN1CCN(Cc2ccncc2)CC1 |
| InChI | InChI=1S/C27H27F6N3O2/c1-38-24-16-21(20-4-6-23(7-5-20)25(37,26(28,29)30)27(31,32)33)2-3-22(24)18-36-14-12-35(13-15-36)17-19-8-10-34-11-9-19/h2-11,16,37H,12-15,17-18H2,1H3 |
| InChIKey | BSUSTUNQJHDXQH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 48.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |