C23H23FN6O — CID 71470714
[2-[4,6-bis(trideuteriomethyl)pyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(3-fluoro-2-pyrimidin-2-ylphenyl)methanone (PubChem CID 71470714) has the molecular formula C23H23FN6O and a molecular weight of 424.51 g/mol. Its IUPAC name is [2-[4,6-bis(trideuteriomethyl)pyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(3-fluoro-2-pyrimidin-2-ylphenyl)methanone.
| Compound Name | [2-[4,6-bis(trideuteriomethyl)pyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(3-fluoro-2-pyrimidin-2-ylphenyl)methanone |
|---|---|
| PubChem CID | 71470714 |
| Molecular Formula | C23H23FN6O |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | [2-[4,6-bis(trideuteriomethyl)pyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(3-fluoro-2-pyrimidin-2-ylphenyl)methanone |
| SMILES | [2H]C([2H])([2H])c1cc(C([2H])([2H])[2H])nc(N2CC3CN(C(=O)c4cccc(F)c4-c4ncccn4)CC3C2)n1 |
| InChI | InChI=1S/C23H23FN6O/c1-14-9-15(2)28-23(27-14)30-12-16-10-29(11-17(16)13-30)22(31)18-5-3-6-19(24)20(18)21-25-7-4-8-26-21/h3-9,16-17H,10-13H2,1-2H3/i1D3,2D3 |
| InChIKey | FPWNRYVTJLOJGZ-WFGJKAKNSA-N |
| XLogP | 2.90 |
| TPSA | 75.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |