C23H25N5O4S — CID 71470873
7-amino-1,3,10-trimethoxy-6-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acridin-9-one (PubChem CID 71470873) has the molecular formula C23H25N5O4S and a molecular weight of 467.55 g/mol. Its IUPAC name is 7-amino-1,3,10-trimethoxy-6-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acridin-9-one.
| Compound Name | 7-amino-1,3,10-trimethoxy-6-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acridin-9-one |
|---|---|
| PubChem CID | 71470873 |
| Molecular Formula | C23H25N5O4S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 7-amino-1,3,10-trimethoxy-6-[4-(1,3-thiazol-2-yl)piperazin-1-yl]acridin-9-one |
| SMILES | COc1cc(OC)c2c(=O)c3cc(N)c(N4CCN(c5nccs5)CC4)cc3n(OC)c2c1 |
| InChI | InChI=1S/C23H25N5O4S/c1-30-14-10-19-21(20(11-14)31-2)22(29)15-12-16(24)18(13-17(15)28(19)32-3)26-5-7-27(8-6-26)23-25-4-9-33-23/h4,9-13H,5-8,24H2,1-3H3 |
| InChIKey | VNTBQYPLHKSAKK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|