C26H24BrF6N3O — CID 71471240
2-[4-[4-[[4-[(2-bromo-4-pyridinyl)methyl]piperazin-1-yl]methyl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 71471240) has the molecular formula C26H24BrF6N3O and a molecular weight of 588.39 g/mol. Its IUPAC name is 2-[4-[4-[[4-[(2-bromo-4-pyridinyl)methyl]piperazin-1-yl]methyl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[4-[[4-[(2-bromo-4-pyridinyl)methyl]piperazin-1-yl]methyl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 71471240 |
| Molecular Formula | C26H24BrF6N3O |
| Molecular Weight | 588.39 g/mol |
| Exact Mass | 587.10 |
| IUPAC Name | 2-[4-[4-[[4-[(2-bromo-4-pyridinyl)methyl]piperazin-1-yl]methyl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(c1ccc(-c2ccc(CN3CCN(Cc4ccnc(Br)c4)CC3)cc2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C26H24BrF6N3O/c27-23-15-19(9-10-34-23)17-36-13-11-35(12-14-36)16-18-1-3-20(4-2-18)21-5-7-22(8-6-21)24(37,25(28,29)30)26(31,32)33/h1-10,15,37H,11-14,16-17H2 |
| InChIKey | HOSVKMYYXLJNAG-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.39 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|