C22H20F6N2O4S — CID 71471457
(3aR,7aS)-5-[4-(2,2,2-trifluoroethoxy)phenyl]-2-[2-(trifluoromethyl)phenyl]sulfonyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one (PubChem CID 71471457) has the molecular formula C22H20F6N2O4S and a molecular weight of 522.47 g/mol. Its IUPAC name is (3aR,7aS)-5-[4-(2,2,2-trifluoroethoxy)phenyl]-2-[2-(trifluoromethyl)phenyl]sulfonyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one.
| Compound Name | (3aR,7aS)-5-[4-(2,2,2-trifluoroethoxy)phenyl]-2-[2-(trifluoromethyl)phenyl]sulfonyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
|---|---|
| PubChem CID | 71471457 |
| Molecular Formula | C22H20F6N2O4S |
| Molecular Weight | 522.47 g/mol |
| Exact Mass | 522.10 |
| IUPAC Name | (3aR,7aS)-5-[4-(2,2,2-trifluoroethoxy)phenyl]-2-[2-(trifluoromethyl)phenyl]sulfonyl-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-4-one |
| SMILES | O=C1[C@H]2CN(S(=O)(=O)c3ccccc3C(F)(F)F)C[C@H]2CCN1c1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C22H20F6N2O4S/c23-21(24,25)13-34-16-7-5-15(6-8-16)30-10-9-14-11-29(12-17(14)20(30)31)35(32,33)19-4-2-1-3-18(19)22(26,27)28/h1-8,14,17H,9-13H2/t14-,17+/m1/s1 |
| InChIKey | BWVIKPJQQKIUGB-PBHICJAKSA-N |
| XLogP | 4.32 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |