About N-(6-chloro-2-methoxyacridin-9-yl)-N'-cyclopropyl-N'-ethylbutane-1,4-diamine
N-(6-chloro-2-methoxyacridin-9-yl)-N'-cyclopropyl-N'-ethylbutane-1,4-diamine (PubChem CID 71471685) has the molecular formula C23H28ClN3O
and a molecular weight of 397.95 g/mol. Its IUPAC name is N-(6-chloro-2-methoxyacridin-9-yl)-N'-cyclopropyl-N'-ethylbutane-1,4-diamine.
Molecular Properties
| Compound Name | N-(6-chloro-2-methoxyacridin-9-yl)-N'-cyclopropyl-N'-ethylbutane-1,4-diamine |
| PubChem CID | 71471685 |
| Molecular Formula | C23H28ClN3O |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | N-(6-chloro-2-methoxyacridin-9-yl)-N'-cyclopropyl-N'-ethylbutane-1,4-diamine |
| SMILES | CCN(CCCCNc1c2ccc(Cl)cc2nc2ccc(OC)cc12)C1CC1 |
| InChI | InChI=1S/C23H28ClN3O/c1-3-27(17-7-8-17)13-5-4-12-25-23-19-10-6-16(24)14-22(19)26-21-11-9-18(28-2)15-20(21)23/h6,9-11,14-15,17H,3-5,7-8,12-13H2,1-2H3,(H,25,26) |
| InChIKey | DLSYLWWLBOCXBR-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze N-(6-chloro-2-methoxyacridin-9-yl)-N'-cyclopropyl-N'-ethylbutane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-chloro-2-methoxyacridin-9-yl)-N'-cyclopropyl-N'-ethylbutane-1,4-diamine?
The IUPAC name of N-(6-chloro-2-methoxyacridin-9-yl)-N'-cyclopropyl-N'-ethylbutane-1,4-diamine (CID 71471685) is N-(6-chloro-2-methoxyacridin-9-yl)-N'-cyclopropyl-N'-ethylbutane-1,4-diamine.
What is the SMILES notation for N-(6-chloro-2-methoxyacridin-9-yl)-N'-cyclopropyl-N'-ethylbutane-1,4-diamine?
The canonical SMILES for N-(6-chloro-2-methoxyacridin-9-yl)-N'-cyclopropyl-N'-ethylbutane-1,4-diamine is CCN(CCCCNc1c2ccc(Cl)cc2nc2ccc(OC)cc12)C1CC1.
What is the InChIKey of N-(6-chloro-2-methoxyacridin-9-yl)-N'-cyclopropyl-N'-ethylbutane-1,4-diamine?
The InChIKey is DLSYLWWLBOCXBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28ClN3O/c1-3-27(17-7-8-17)13-5-4-12-25-23-19-10-6-16(24)14-22(19)26-21-11-9-18(28-2)15-20(21)23/h6,9-11,14-15,17H,3-5,7-8,12-13H2,1-2H3,(H,25,26).
What are the key properties of N-(6-chloro-2-methoxyacridin-9-yl)-N'-cyclopropyl-N'-ethylbutane-1,4-diamine?
N-(6-chloro-2-methoxyacridin-9-yl)-N'-cyclopropyl-N'-ethylbutane-1,4-diamine has a molecular weight of 397.95 g/mol, XLogP of 5.73, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-chloro-2-methoxyacridin-9-yl)-N'-cyclopropyl-N'-ethylbutane-1,4-diamine is sourced from PubChem (CID 71471685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).