About 2-chloro-9-methylpurine
2-chloro-9-methylpurine (PubChem CID 7147173) has the molecular formula C6H5ClN4
and a molecular weight of 168.59 g/mol. Its IUPAC name is 2-chloro-9-methylpurine.
Molecular Properties
| Compound Name | 2-chloro-9-methylpurine |
| PubChem CID | 7147173 |
| Molecular Formula | C6H5ClN4 |
| Molecular Weight | 168.59 g/mol |
| Exact Mass | 168.02 |
| IUPAC Name | 2-chloro-9-methylpurine |
| SMILES | Cn1cnc2cnc(Cl)nc21 |
| InChI | InChI=1S/C6H5ClN4/c1-11-3-9-4-2-8-6(7)10-5(4)11/h2-3H,1H3 |
| InChIKey | AMVDDOZWEOPXRR-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.59 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-9-methylpurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-9-methylpurine?
The IUPAC name of 2-chloro-9-methylpurine (CID 7147173) is 2-chloro-9-methylpurine.
What is the SMILES notation for 2-chloro-9-methylpurine?
The canonical SMILES for 2-chloro-9-methylpurine is Cn1cnc2cnc(Cl)nc21.
What is the InChIKey of 2-chloro-9-methylpurine?
The InChIKey is AMVDDOZWEOPXRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClN4/c1-11-3-9-4-2-8-6(7)10-5(4)11/h2-3H,1H3.
What are the key properties of 2-chloro-9-methylpurine?
2-chloro-9-methylpurine has a molecular weight of 168.59 g/mol, XLogP of 1.02, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-9-methylpurine is sourced from PubChem (CID 7147173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).