C21H19N5O3S — CID 71471788
(5Z)-5-[[4-[[7-(2,2-dimethylpropanoyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]amino]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 71471788) has the molecular formula C21H19N5O3S and a molecular weight of 421.48 g/mol. Its IUPAC name is (5Z)-5-[[4-[[7-(2,2-dimethylpropanoyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]amino]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-[[7-(2,2-dimethylpropanoyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]amino]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 71471788 |
| Molecular Formula | C21H19N5O3S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | (5Z)-5-[[4-[[7-(2,2-dimethylpropanoyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]amino]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)(C)C(=O)c1c[nH]c2ncc(Nc3ccc(/C=C4\SC(=O)NC4=O)cc3)nc12 |
| InChI | InChI=1S/C21H19N5O3S/c1-21(2,3)17(27)13-9-22-18-16(13)25-15(10-23-18)24-12-6-4-11(5-7-12)8-14-19(28)26-20(29)30-14/h4-10H,1-3H3,(H,22,23)(H,24,25)(H,26,28,29)/b14-8- |
| InChIKey | ZEKMHJMIMRPSOF-ZSOIEALJSA-N |
| XLogP | 4.25 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|