C23H23ClN6O2 — CID 71471859
(E)-3-[2-chloro-4-[[7-(2,2-dimethylpropanoyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]amino]phenyl]-2-cyano-N,N-dimethylprop-2-enamide (PubChem CID 71471859) has the molecular formula C23H23ClN6O2 and a molecular weight of 450.93 g/mol. Its IUPAC name is (E)-3-[2-chloro-4-[[7-(2,2-dimethylpropanoyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]amino]phenyl]-2-cyano-N,N-dimethylprop-2-enamide.
| Compound Name | (E)-3-[2-chloro-4-[[7-(2,2-dimethylpropanoyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]amino]phenyl]-2-cyano-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 71471859 |
| Molecular Formula | C23H23ClN6O2 |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | (E)-3-[2-chloro-4-[[7-(2,2-dimethylpropanoyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]amino]phenyl]-2-cyano-N,N-dimethylprop-2-enamide |
| SMILES | CN(C)C(=O)/C(C#N)=C/c1ccc(Nc2cnc3[nH]cc(C(=O)C(C)(C)C)c3n2)cc1Cl |
| InChI | InChI=1S/C23H23ClN6O2/c1-23(2,3)20(31)16-11-26-21-19(16)29-18(12-27-21)28-15-7-6-13(17(24)9-15)8-14(10-25)22(32)30(4)5/h6-9,11-12H,1-5H3,(H,26,27)(H,28,29)/b14-8+ |
| InChIKey | NFFYSXNCFJIIDU-RIYZIHGNSA-N |
| XLogP | 4.58 |
| TPSA | 114.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|