About 2-chloro-4-N,6-dimethylpyrimidine-4,5-diamine
2-chloro-4-N,6-dimethylpyrimidine-4,5-diamine (PubChem CID 7147190) has the molecular formula C6H9ClN4
and a molecular weight of 172.62 g/mol. Its IUPAC name is 2-chloro-4-N,6-dimethylpyrimidine-4,5-diamine.
Molecular Properties
| Compound Name | 2-chloro-4-N,6-dimethylpyrimidine-4,5-diamine |
| PubChem CID | 7147190 |
| Molecular Formula | C6H9ClN4 |
| Molecular Weight | 172.62 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | 2-chloro-4-N,6-dimethylpyrimidine-4,5-diamine |
| SMILES | CNc1nc(Cl)nc(C)c1N |
| InChI | InChI=1S/C6H9ClN4/c1-3-4(8)5(9-2)11-6(7)10-3/h8H2,1-2H3,(H,9,10,11) |
| InChIKey | GRKBHWUDUVHOQC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.62 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-4-N,6-dimethylpyrimidine-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-N,6-dimethylpyrimidine-4,5-diamine?
The IUPAC name of 2-chloro-4-N,6-dimethylpyrimidine-4,5-diamine (CID 7147190) is 2-chloro-4-N,6-dimethylpyrimidine-4,5-diamine.
What is the SMILES notation for 2-chloro-4-N,6-dimethylpyrimidine-4,5-diamine?
The canonical SMILES for 2-chloro-4-N,6-dimethylpyrimidine-4,5-diamine is CNc1nc(Cl)nc(C)c1N.
What is the InChIKey of 2-chloro-4-N,6-dimethylpyrimidine-4,5-diamine?
The InChIKey is GRKBHWUDUVHOQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClN4/c1-3-4(8)5(9-2)11-6(7)10-3/h8H2,1-2H3,(H,9,10,11).
What are the key properties of 2-chloro-4-N,6-dimethylpyrimidine-4,5-diamine?
2-chloro-4-N,6-dimethylpyrimidine-4,5-diamine has a molecular weight of 172.62 g/mol, XLogP of 1.06, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-N,6-dimethylpyrimidine-4,5-diamine is sourced from PubChem (CID 7147190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).