C24H25N7O3 — CID 71472040
2-[4-[(E)-2-cyano-3-morpholin-4-yl-3-oxoprop-1-enyl]anilino]-N-propan-2-yl-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71472040) has the molecular formula C24H25N7O3 and a molecular weight of 459.51 g/mol. Its IUPAC name is 2-[4-[(E)-2-cyano-3-morpholin-4-yl-3-oxoprop-1-enyl]anilino]-N-propan-2-yl-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-[4-[(E)-2-cyano-3-morpholin-4-yl-3-oxoprop-1-enyl]anilino]-N-propan-2-yl-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71472040 |
| Molecular Formula | C24H25N7O3 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 2-[4-[(E)-2-cyano-3-morpholin-4-yl-3-oxoprop-1-enyl]anilino]-N-propan-2-yl-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CC(C)NC(=O)c1c[nH]c2ncc(Nc3ccc(/C=C(\C#N)C(=O)N4CCOCC4)cc3)nc12 |
| InChI | InChI=1S/C24H25N7O3/c1-15(2)28-23(32)19-13-26-22-21(19)30-20(14-27-22)29-18-5-3-16(4-6-18)11-17(12-25)24(33)31-7-9-34-10-8-31/h3-6,11,13-15H,7-10H2,1-2H3,(H,26,27)(H,28,32)(H,29,30)/b17-11+ |
| InChIKey | AHZXVGZMZKUECM-GZTJUZNOSA-N |
| XLogP | 2.61 |
| TPSA | 136.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|