C28H26N6O2 — CID 71472043
(E)-2-cyano-3-[4-[[7-(2,2-dimethylpropanoyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]amino]phenyl]-N-methyl-N-phenylprop-2-enamide (PubChem CID 71472043) has the molecular formula C28H26N6O2 and a molecular weight of 478.56 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-[[7-(2,2-dimethylpropanoyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]amino]phenyl]-N-methyl-N-phenylprop-2-enamide.
| Compound Name | (E)-2-cyano-3-[4-[[7-(2,2-dimethylpropanoyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]amino]phenyl]-N-methyl-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 71472043 |
| Molecular Formula | C28H26N6O2 |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | (E)-2-cyano-3-[4-[[7-(2,2-dimethylpropanoyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]amino]phenyl]-N-methyl-N-phenylprop-2-enamide |
| SMILES | CN(C(=O)/C(C#N)=C/c1ccc(Nc2cnc3[nH]cc(C(=O)C(C)(C)C)c3n2)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H26N6O2/c1-28(2,3)25(35)22-16-30-26-24(22)33-23(17-31-26)32-20-12-10-18(11-13-20)14-19(15-29)27(36)34(4)21-8-6-5-7-9-21/h5-14,16-17H,1-4H3,(H,30,31)(H,32,33)/b19-14+ |
| InChIKey | OHRZDYHTXBCADX-XMHGGMMESA-N |
| XLogP | 5.50 |
| TPSA | 114.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|