About 1-(6-chloro-2,3-dihydropyrrolo[3,2-c]pyridin-1-yl)-2-[(3R)-3-methylpiperazin-1-yl]ethanone
1-(6-chloro-2,3-dihydropyrrolo[3,2-c]pyridin-1-yl)-2-[(3R)-3-methylpiperazin-1-yl]ethanone (PubChem CID 71472080) has the molecular formula C14H19ClN4O
and a molecular weight of 294.79 g/mol. Its IUPAC name is 1-(6-chloro-2,3-dihydropyrrolo[3,2-c]pyridin-1-yl)-2-[(3R)-3-methylpiperazin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-(6-chloro-2,3-dihydropyrrolo[3,2-c]pyridin-1-yl)-2-[(3R)-3-methylpiperazin-1-yl]ethanone |
| PubChem CID | 71472080 |
| Molecular Formula | C14H19ClN4O |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 1-(6-chloro-2,3-dihydropyrrolo[3,2-c]pyridin-1-yl)-2-[(3R)-3-methylpiperazin-1-yl]ethanone |
| SMILES | C[C@@H]1CN(CC(=O)N2CCc3cnc(Cl)cc32)CCN1 |
| InChI | InChI=1S/C14H19ClN4O/c1-10-8-18(5-3-16-10)9-14(20)19-4-2-11-7-17-13(15)6-12(11)19/h6-7,10,16H,2-5,8-9H2,1H3/t10-/m1/s1 |
| InChIKey | UIUNSWTUDREESN-SNVBAGLBSA-N |
| XLogP | 0.92 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-(6-chloro-2,3-dihydropyrrolo[3,2-c]pyridin-1-yl)-2-[(3R)-3-methylpiperazin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-chloro-2,3-dihydropyrrolo[3,2-c]pyridin-1-yl)-2-[(3R)-3-methylpiperazin-1-yl]ethanone?
The IUPAC name of 1-(6-chloro-2,3-dihydropyrrolo[3,2-c]pyridin-1-yl)-2-[(3R)-3-methylpiperazin-1-yl]ethanone (CID 71472080) is 1-(6-chloro-2,3-dihydropyrrolo[3,2-c]pyridin-1-yl)-2-[(3R)-3-methylpiperazin-1-yl]ethanone.
What is the SMILES notation for 1-(6-chloro-2,3-dihydropyrrolo[3,2-c]pyridin-1-yl)-2-[(3R)-3-methylpiperazin-1-yl]ethanone?
The canonical SMILES for 1-(6-chloro-2,3-dihydropyrrolo[3,2-c]pyridin-1-yl)-2-[(3R)-3-methylpiperazin-1-yl]ethanone is C[C@@H]1CN(CC(=O)N2CCc3cnc(Cl)cc32)CCN1.
What is the InChIKey of 1-(6-chloro-2,3-dihydropyrrolo[3,2-c]pyridin-1-yl)-2-[(3R)-3-methylpiperazin-1-yl]ethanone?
The InChIKey is UIUNSWTUDREESN-SNVBAGLBSA-N. The full InChI is InChI=1S/C14H19ClN4O/c1-10-8-18(5-3-16-10)9-14(20)19-4-2-11-7-17-13(15)6-12(11)19/h6-7,10,16H,2-5,8-9H2,1H3/t10-/m1/s1.
What are the key properties of 1-(6-chloro-2,3-dihydropyrrolo[3,2-c]pyridin-1-yl)-2-[(3R)-3-methylpiperazin-1-yl]ethanone?
1-(6-chloro-2,3-dihydropyrrolo[3,2-c]pyridin-1-yl)-2-[(3R)-3-methylpiperazin-1-yl]ethanone has a molecular weight of 294.79 g/mol, XLogP of 0.92, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-chloro-2,3-dihydropyrrolo[3,2-c]pyridin-1-yl)-2-[(3R)-3-methylpiperazin-1-yl]ethanone is sourced from PubChem (CID 71472080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).