C19H14N4O4S2 — CID 71472157
(5E)-5-[[4-[2-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 71472157) has the molecular formula C19H14N4O4S2 and a molecular weight of 426.48 g/mol. Its IUPAC name is (5E)-5-[[4-[2-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-[2-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 71472157 |
| Molecular Formula | C19H14N4O4S2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | (5E)-5-[[4-[2-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2ccc(OCCSc3nnc(-c4ccncc4)o3)cc2)S1 |
| InChI | InChI=1S/C19H14N4O4S2/c24-16-15(29-18(25)21-16)11-12-1-3-14(4-2-12)26-9-10-28-19-23-22-17(27-19)13-5-7-20-8-6-13/h1-8,11H,9-10H2,(H,21,24,25)/b15-11+ |
| InChIKey | CDQITBARTLUYTF-RVDMUPIBSA-N |
| XLogP | 3.63 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|