C25H39N3O4 — CID 71472540
(E,4R)-2,5-dimethyl-4-[[(2S)-3-methyl-2-[2-(2-phenylpropan-2-ylamino)propanoylamino]butanoyl]amino]hex-2-enoic acid (PubChem CID 71472540) has the molecular formula C25H39N3O4 and a molecular weight of 445.60 g/mol. Its IUPAC name is (E,4R)-2,5-dimethyl-4-[[(2S)-3-methyl-2-[2-(2-phenylpropan-2-ylamino)propanoylamino]butanoyl]amino]hex-2-enoic acid.
| Compound Name | (E,4R)-2,5-dimethyl-4-[[(2S)-3-methyl-2-[2-(2-phenylpropan-2-ylamino)propanoylamino]butanoyl]amino]hex-2-enoic acid |
|---|---|
| PubChem CID | 71472540 |
| Molecular Formula | C25H39N3O4 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.29 |
| IUPAC Name | (E,4R)-2,5-dimethyl-4-[[(2S)-3-methyl-2-[2-(2-phenylpropan-2-ylamino)propanoylamino]butanoyl]amino]hex-2-enoic acid |
| SMILES | C/C(=C\[C@H](NC(=O)[C@@H](NC(=O)C(C)NC(C)(C)c1ccccc1)C(C)C)C(C)C)C(=O)O |
| InChI | InChI=1S/C25H39N3O4/c1-15(2)20(14-17(5)24(31)32)26-23(30)21(16(3)4)27-22(29)18(6)28-25(7,8)19-12-10-9-11-13-19/h9-16,18,20-21,28H,1-8H3,(H,26,30)(H,27,29)(H,31,32)/b17-14+/t18?,20-,21-/m0/s1 |
| InChIKey | VGSFSUCZYAWWRD-GPVOAWSYSA-N |
| XLogP | 3.21 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|