C22H22N6O3 — CID 71472577
2-[3-[(E)-2-cyano-3-(dimethylamino)-3-oxoprop-1-enyl]phenoxy]-N-propan-2-yl-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 71472577) has the molecular formula C22H22N6O3 and a molecular weight of 418.46 g/mol. Its IUPAC name is 2-[3-[(E)-2-cyano-3-(dimethylamino)-3-oxoprop-1-enyl]phenoxy]-N-propan-2-yl-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-[3-[(E)-2-cyano-3-(dimethylamino)-3-oxoprop-1-enyl]phenoxy]-N-propan-2-yl-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 71472577 |
| Molecular Formula | C22H22N6O3 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 2-[3-[(E)-2-cyano-3-(dimethylamino)-3-oxoprop-1-enyl]phenoxy]-N-propan-2-yl-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | CC(C)NC(=O)c1c[nH]c2ncc(Oc3cccc(/C=C(\C#N)C(=O)N(C)C)c3)nc12 |
| InChI | InChI=1S/C22H22N6O3/c1-13(2)26-21(29)17-11-24-20-19(17)27-18(12-25-20)31-16-7-5-6-14(9-16)8-15(10-23)22(30)28(3)4/h5-9,11-13H,1-4H3,(H,24,25)(H,26,29)/b15-8+ |
| InChIKey | FLQBMDSYGQZCCU-OVCLIPMQSA-N |
| XLogP | 2.88 |
| TPSA | 124.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|