C22H21N5O2 — CID 71472651
(E)-2-cyano-N,N-dimethyl-3-[4-[7-(2-methylpropanoyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]phenyl]prop-2-enamide (PubChem CID 71472651) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is (E)-2-cyano-N,N-dimethyl-3-[4-[7-(2-methylpropanoyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N,N-dimethyl-3-[4-[7-(2-methylpropanoyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 71472651 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | (E)-2-cyano-N,N-dimethyl-3-[4-[7-(2-methylpropanoyl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]phenyl]prop-2-enamide |
| SMILES | CC(C)C(=O)c1c[nH]c2ncc(-c3ccc(/C=C(\C#N)C(=O)N(C)C)cc3)nc12 |
| InChI | InChI=1S/C22H21N5O2/c1-13(2)20(28)17-11-24-21-19(17)26-18(12-25-21)15-7-5-14(6-8-15)9-16(10-23)22(29)27(3)4/h5-9,11-13H,1-4H3,(H,24,25)/b16-9+ |
| InChIKey | QOFAIKDIHFPQGM-CXUHLZMHSA-N |
| XLogP | 3.46 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|