About 1,4-ditert-butyl-1,4-azaborinine
1,4-ditert-butyl-1,4-azaborinine (PubChem CID 71472840) has the molecular formula C12H22BN
and a molecular weight of 191.13 g/mol. Its IUPAC name is 1,4-ditert-butyl-1,4-azaborinine.
Molecular Properties
| Compound Name | 1,4-ditert-butyl-1,4-azaborinine |
| PubChem CID | 71472840 |
| Molecular Formula | C12H22BN |
| Molecular Weight | 191.13 g/mol |
| Exact Mass | 191.18 |
| IUPAC Name | 1,4-ditert-butyl-1,4-azaborinine |
| SMILES | CC(C)(C)B1C=CN(C(C)(C)C)C=C1 |
| InChI | InChI=1S/C12H22BN/c1-11(2,3)13-7-9-14(10-8-13)12(4,5)6/h7-10H,1-6H3 |
| InChIKey | ZHTICCCPMMIOHB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.13 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,4-ditert-butyl-1,4-azaborinine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-ditert-butyl-1,4-azaborinine?
The IUPAC name of 1,4-ditert-butyl-1,4-azaborinine (CID 71472840) is 1,4-ditert-butyl-1,4-azaborinine.
What is the SMILES notation for 1,4-ditert-butyl-1,4-azaborinine?
The canonical SMILES for 1,4-ditert-butyl-1,4-azaborinine is CC(C)(C)B1C=CN(C(C)(C)C)C=C1.
What is the InChIKey of 1,4-ditert-butyl-1,4-azaborinine?
The InChIKey is ZHTICCCPMMIOHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22BN/c1-11(2,3)13-7-9-14(10-8-13)12(4,5)6/h7-10H,1-6H3.
What are the key properties of 1,4-ditert-butyl-1,4-azaborinine?
1,4-ditert-butyl-1,4-azaborinine has a molecular weight of 191.13 g/mol, XLogP of 3.50, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-ditert-butyl-1,4-azaborinine is sourced from PubChem (CID 71472840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).